C13H17FN4 — CID 86777917
2-[(5-cyano-2-fluorophenyl)methyl]-1,3-diethylguanidine (PubChem CID 86777917) has the molecular formula C13H17FN4 and a molecular weight of 248.30 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methyl]-1,3-diethylguanidine.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1,3-diethylguanidine |
|---|---|
| PubChem CID | 86777917 |
| Molecular Formula | C13H17FN4 |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1,3-diethylguanidine |
| SMILES | CCNC(=NCc1cc(C#N)ccc1F)NCC |
| InChI | InChI=1S/C13H17FN4/c1-3-16-13(17-4-2)18-9-11-7-10(8-15)5-6-12(11)14/h5-7H,3-4,9H2,1-2H3,(H2,16,17,18) |
| InChIKey | HWNDRCJGRAXNSR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|