C15H22FIN4 — CID 111492179
1-butan-2-yl-2-[(5-cyano-2-fluorophenyl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111492179) has the molecular formula C15H22FIN4 and a molecular weight of 404.27 g/mol. Its IUPAC name is 1-butan-2-yl-2-[(5-cyano-2-fluorophenyl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-2-[(5-cyano-2-fluorophenyl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111492179 |
| Molecular Formula | C15H22FIN4 |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-butan-2-yl-2-[(5-cyano-2-fluorophenyl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)NC(C)CC.I |
| InChI | InChI=1S/C15H21FN4.HI/c1-4-11(3)20-15(18-5-2)19-10-13-8-12(9-17)6-7-14(13)16;/h6-8,11H,4-5,10H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | SBKDPUQRNVILJZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|