C20H24FIN4 — CID 111498626
2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[1-(2-methylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111498626) has the molecular formula C20H24FIN4 and a molecular weight of 466.34 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[1-(2-methylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[1-(2-methylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111498626 |
| Molecular Formula | C20H24FIN4 |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[1-(2-methylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)NC(C)c1ccccc1C.I |
| InChI | InChI=1S/C20H23FN4.HI/c1-4-23-20(25-15(3)18-8-6-5-7-14(18)2)24-13-17-11-16(12-22)9-10-19(17)21;/h5-11,15H,4,13H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | IYVPVZFWZZBHJZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|