C17H19ClFIN4OS — CID 111990106
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[(5-cyano-2-fluorophenyl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111990106) has the molecular formula C17H19ClFIN4OS and a molecular weight of 508.79 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[(5-cyano-2-fluorophenyl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[(5-cyano-2-fluorophenyl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111990106 |
| Molecular Formula | C17H19ClFIN4OS |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.00 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[(5-cyano-2-fluorophenyl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)NCC(O)c1ccc(Cl)s1.I |
| InChI | InChI=1S/C17H18ClFN4OS.HI/c1-2-21-17(23-10-14(24)15-5-6-16(18)25-15)22-9-12-7-11(8-20)3-4-13(12)19;/h3-7,14,24H,2,9-10H2,1H3,(H2,21,22,23);1H |
| InChIKey | VUJQZRGGLDXNIE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|