C22H28FN5OS — CID 111998745
2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine (PubChem CID 111998745) has the molecular formula C22H28FN5OS and a molecular weight of 429.57 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine |
|---|---|
| PubChem CID | 111998745 |
| Molecular Formula | C22H28FN5OS |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)NCC(c1ccc(C)s1)N1CCOCC1 |
| InChI | InChI=1S/C22H28FN5OS/c1-3-25-22(26-14-18-12-17(13-24)5-6-19(18)23)27-15-20(21-7-4-16(2)30-21)28-8-10-29-11-9-28/h4-7,12,20H,3,8-11,14-15H2,1-2H3,(H2,25,26,27) |
| InChIKey | GYIDUYLTARVNCI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|