C22H35IN6OS — CID 109406401
2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide (PubChem CID 109406401) has the molecular formula C22H35IN6OS and a molecular weight of 558.53 g/mol. Its IUPAC name is 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide.
| Compound Name | 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109406401 |
| Molecular Formula | C22H35IN6OS |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(N(C)C)n1)NCC(c1ccc(C)s1)N1CCOCC1.I |
| InChI | InChI=1S/C22H34N6OS.HI/c1-5-23-22(24-15-18-7-6-8-21(26-18)27(3)4)25-16-19(20-10-9-17(2)30-20)28-11-13-29-14-12-28;/h6-10,19H,5,11-16H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | CNLJECMSXDZATI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|