C21H33IN4O2S2 — CID 109418923
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide (PubChem CID 109418923) has the molecular formula C21H33IN4O2S2 and a molecular weight of 564.56 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109418923 |
| Molecular Formula | C21H33IN4O2S2 |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCC(c1ccc(C)s1)N1CCOCC1.I |
| InChI | InChI=1S/C21H32N4O2S2.HI/c1-4-22-20(24-15-21(3,26)19-6-5-13-28-19)23-14-17(18-8-7-16(2)29-18)25-9-11-27-12-10-25;/h5-8,13,17,26H,4,9-12,14-15H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | MULPZAQBWCALCI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|