C22H34N4O3S — CID 111660875
2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111660875) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111660875 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cc(C)oc1C)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C22H34N4O3S/c1-5-23-21(25-15-22(4,27)18-13-16(2)29-17(18)3)24-14-19(20-7-6-12-30-20)26-8-10-28-11-9-26/h6-7,12-13,19,27H,5,8-11,14-15H2,1-4H3,(H2,23,24,25) |
| InChIKey | JARKVYGQMWXERF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|