C21H38IN5O3S — CID 111658033
1-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111658033) has the molecular formula C21H38IN5O3S and a molecular weight of 567.54 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111658033 |
| Molecular Formula | C21H38IN5O3S |
| Molecular Weight | 567.54 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)CN1CCOCC1)NCC(c1cccs1)N1CCOCC1.I |
| InChI | InChI=1S/C21H37N5O3S.HI/c1-3-22-20(24-16-21(2,27)17-25-6-10-28-11-7-25)23-15-18(19-5-4-14-30-19)26-8-12-29-13-9-26;/h4-5,14,18,27H,3,6-13,15-17H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | HXVHVGFCVZPRFI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.54 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|