C22H41IN6OS — CID 111284728
1-ethyl-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111284728) has the molecular formula C22H41IN6OS and a molecular weight of 564.58 g/mol. Its IUPAC name is 1-ethyl-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111284728 |
| Molecular Formula | C22H41IN6OS |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 1-ethyl-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)CN1CCN(C)CC1)NCC(c1cccs1)N1CCOCC1.I |
| InChI | InChI=1S/C22H40N6OS.HI/c1-4-23-22(24-16-19(2)18-27-9-7-26(3)8-10-27)25-17-20(21-6-5-15-30-21)28-11-13-29-14-12-28;/h5-6,15,19-20H,4,7-14,16-18H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | GRUXPKFMXDERLF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|