C21H38N6OS — CID 111284407
1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111284407) has the molecular formula C21H38N6OS and a molecular weight of 422.64 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111284407 |
| Molecular Formula | C21H38N6OS |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCN1CCCN(C)CC1 |
| InChI | InChI=1S/C21H38N6OS/c1-3-22-21(23-7-10-26-9-5-8-25(2)11-12-26)24-18-19(20-6-4-17-29-20)27-13-15-28-16-14-27/h4,6,17,19H,3,5,7-16,18H2,1-2H3,(H2,22,23,24) |
| InChIKey | HSKADWWDEYKIPU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|