C19H33N5OS — CID 111012147
1-ethyl-3-(2-morpholin-4-ylethyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111012147) has the molecular formula C19H33N5OS and a molecular weight of 379.57 g/mol. Its IUPAC name is 1-ethyl-3-(2-morpholin-4-ylethyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-(2-morpholin-4-ylethyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111012147 |
| Molecular Formula | C19H33N5OS |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 1-ethyl-3-(2-morpholin-4-ylethyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCCC1)NCCN1CCOCC1 |
| InChI | InChI=1S/C19H33N5OS/c1-2-20-19(21-7-10-23-11-13-25-14-12-23)22-16-17(18-6-5-15-26-18)24-8-3-4-9-24/h5-6,15,17H,2-4,7-14,16H2,1H3,(H2,20,21,22) |
| InChIKey | PXMSSQGFLYJSCQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|