C15H27N5O3S2 — CID 111284759
1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-(2-sulfamoylethyl)guanidine (PubChem CID 111284759) has the molecular formula C15H27N5O3S2 and a molecular weight of 389.55 g/mol. Its IUPAC name is 1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-(2-sulfamoylethyl)guanidine.
| Compound Name | 1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-(2-sulfamoylethyl)guanidine |
|---|---|
| PubChem CID | 111284759 |
| Molecular Formula | C15H27N5O3S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-(2-sulfamoylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCS(N)(=O)=O |
| InChI | InChI=1S/C15H27N5O3S2/c1-2-17-15(18-5-11-25(16,21)22)19-12-13(14-4-3-10-24-14)20-6-8-23-9-7-20/h3-4,10,13H,2,5-9,11-12H2,1H3,(H2,16,21,22)(H2,17,18,19) |
| InChIKey | WOTXCNSYCSROLX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|