C22H39N5O2S — CID 111283627
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111283627) has the molecular formula C22H39N5O2S and a molecular weight of 437.65 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111283627 |
| Molecular Formula | C22H39N5O2S |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C22H39N5O2S/c1-4-23-22(24-8-6-9-26-16-18(2)29-19(3)17-26)25-15-20(21-7-5-14-30-21)27-10-12-28-13-11-27/h5,7,14,18-20H,4,6,8-13,15-17H2,1-3H3,(H2,23,24,25) |
| InChIKey | KGWIYRHOGFPSQN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|