C22H32N4O2S — CID 111283759
1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-(3-phenoxypropyl)guanidine (PubChem CID 111283759) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is 1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-(3-phenoxypropyl)guanidine.
| Compound Name | 1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-(3-phenoxypropyl)guanidine |
|---|---|
| PubChem CID | 111283759 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-(3-phenoxypropyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCCOc1ccccc1 |
| InChI | InChI=1S/C22H32N4O2S/c1-2-23-22(24-11-7-14-28-19-8-4-3-5-9-19)25-18-20(21-10-6-17-29-21)26-12-15-27-16-13-26/h3-6,8-10,17,20H,2,7,11-16,18H2,1H3,(H2,23,24,25) |
| InChIKey | AGVCNYGMFYLGCP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|