C21H28F2N4OS — CID 111283481
1-[2-(2,6-difluorophenyl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111283481) has the molecular formula C21H28F2N4OS and a molecular weight of 422.55 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[2-(2,6-difluorophenyl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111283481 |
| Molecular Formula | C21H28F2N4OS |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCc1c(F)cccc1F |
| InChI | InChI=1S/C21H28F2N4OS/c1-2-24-21(25-9-8-16-17(22)5-3-6-18(16)23)26-15-19(20-7-4-14-29-20)27-10-12-28-13-11-27/h3-7,14,19H,2,8-13,15H2,1H3,(H2,24,25,26) |
| InChIKey | IPDPOXCUNJQGPY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|