C19H29N5OS2 — CID 111795323
1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111795323) has the molecular formula C19H29N5OS2 and a molecular weight of 407.61 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111795323 |
| Molecular Formula | C19H29N5OS2 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-ethyl-3-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCc1ncc(C)s1 |
| InChI | InChI=1S/C19H29N5OS2/c1-3-20-19(21-7-6-18-22-13-15(2)27-18)23-14-16(17-5-4-12-26-17)24-8-10-25-11-9-24/h4-5,12-13,16H,3,6-11,14H2,1-2H3,(H2,20,21,23) |
| InChIKey | HABVGWZFOYFRBK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|