C21H32IN5OS — CID 109402082
1-ethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 109402082) has the molecular formula C21H32IN5OS and a molecular weight of 529.49 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109402082 |
| Molecular Formula | C21H32IN5OS |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 1-ethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCc1ccncc1C.I |
| InChI | InChI=1S/C21H31N5OS.HI/c1-3-23-21(24-9-7-18-6-8-22-15-17(18)2)25-16-19(20-5-4-14-28-20)26-10-12-27-13-11-26;/h4-6,8,14-15,19H,3,7,9-13,16H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | RIMJTTRTHKXASJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|