C18H29IN6OS — CID 111284542
1-ethyl-3-(2-imidazol-1-ylethyl)-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111284542) has the molecular formula C18H29IN6OS and a molecular weight of 504.44 g/mol. Its IUPAC name is 1-ethyl-3-(2-imidazol-1-ylethyl)-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-imidazol-1-ylethyl)-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111284542 |
| Molecular Formula | C18H29IN6OS |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 1-ethyl-3-(2-imidazol-1-ylethyl)-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCn1ccnc1.I |
| InChI | InChI=1S/C18H28N6OS.HI/c1-2-20-18(21-6-8-23-7-5-19-15-23)22-14-16(17-4-3-13-26-17)24-9-11-25-12-10-24;/h3-5,7,13,15-16H,2,6,8-12,14H2,1H3,(H2,20,21,22);1H |
| InChIKey | ZMYQYIHSPRXXGU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|