C21H30IN7OS — CID 111284240
1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111284240) has the molecular formula C21H30IN7OS and a molecular weight of 555.49 g/mol. Its IUPAC name is 1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111284240 |
| Molecular Formula | C21H30IN7OS |
| Molecular Weight | 555.49 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | 1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCc1nnc2ccccn12.I |
| InChI | InChI=1S/C21H29N7OS.HI/c1-2-22-21(23-9-8-20-26-25-19-7-3-4-10-28(19)20)24-16-17(18-6-5-15-30-18)27-11-13-29-14-12-27;/h3-7,10,15,17H,2,8-9,11-14,16H2,1H3,(H2,22,23,24);1H |
| InChIKey | MWHWCYZSBDUHFH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|