C19H27IN6S — CID 111673427
1-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111673427) has the molecular formula C19H27IN6S and a molecular weight of 498.44 g/mol. Its IUPAC name is 1-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111673427 |
| Molecular Formula | C19H27IN6S |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 1-ethyl-2-(2-methyl-3-thiophen-2-ylpropyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)Cc1cccs1)NCCc1nnc2ccccn12.I |
| InChI | InChI=1S/C19H26N6S.HI/c1-3-20-19(22-14-15(2)13-16-7-6-12-26-16)21-10-9-18-24-23-17-8-4-5-11-25(17)18;/h4-8,11-12,15H,3,9-10,13-14H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | NTQSIKLQZHJHFW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|