C18H21N9 — CID 111015771
1-ethyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111015771) has the molecular formula C18H21N9 and a molecular weight of 363.43 g/mol. Its IUPAC name is 1-ethyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111015771 |
| Molecular Formula | C18H21N9 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 1-ethyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCc1nnc2ccccn12 |
| InChI | InChI=1S/C18H21N9/c1-2-19-18(21-13-17-25-23-15-8-4-6-12-27(15)17)20-10-9-16-24-22-14-7-3-5-11-26(14)16/h3-8,11-12H,2,9-10,13H2,1H3,(H2,19,20,21) |
| InChIKey | KHKLNTZWCKLSAD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|