C22H27IN8 — CID 111850695
1-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111850695) has the molecular formula C22H27IN8 and a molecular weight of 530.42 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111850695 |
| Molecular Formula | C22H27IN8 |
| Molecular Weight | 530.42 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 1-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cn1cccn1)NCCc1nnc2ccccn12.I |
| InChI | InChI=1S/C22H26N8.HI/c1-2-23-22(24-13-11-21-28-27-20-10-5-6-15-30(20)21)25-16-18-8-3-4-9-19(18)17-29-14-7-12-26-29;/h3-10,12,14-15H,2,11,13,16-17H2,1H3,(H2,23,24,25);1H |
| InChIKey | VQTOTRKGUBBNJG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|