C17H21N7 — CID 111016367
1-ethyl-3-(2-pyridin-3-ylethyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111016367) has the molecular formula C17H21N7 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-ethyl-3-(2-pyridin-3-ylethyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-(2-pyridin-3-ylethyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111016367 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 1-ethyl-3-(2-pyridin-3-ylethyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCc1cccnc1 |
| InChI | InChI=1S/C17H21N7/c1-2-19-17(20-10-8-14-6-5-9-18-12-14)21-13-16-23-22-15-7-3-4-11-24(15)16/h3-7,9,11-12H,2,8,10,13H2,1H3,(H2,19,20,21) |
| InChIKey | QZRFDUXABASYNY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|