C19H32N6 — CID 111015917
1-ethyl-3-nonyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111015917) has the molecular formula C19H32N6 and a molecular weight of 344.51 g/mol. Its IUPAC name is 1-ethyl-3-nonyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-nonyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111015917 |
| Molecular Formula | C19H32N6 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 1-ethyl-3-nonyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCCCCCCCCN/C(=N/Cc1nnc2ccccn12)NCC |
| InChI | InChI=1S/C19H32N6/c1-3-5-6-7-8-9-11-14-21-19(20-4-2)22-16-18-24-23-17-13-10-12-15-25(17)18/h10,12-13,15H,3-9,11,14,16H2,1-2H3,(H2,20,21,22) |
| InChIKey | IYBGSGVIRMTVEO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|