C16H27N7O2S — CID 111015443
1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111015443) has the molecular formula C16H27N7O2S and a molecular weight of 381.51 g/mol. Its IUPAC name is 1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111015443 |
| Molecular Formula | C16H27N7O2S |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCCN(C)S(=O)(=O)CC |
| InChI | InChI=1S/C16H27N7O2S/c1-4-17-16(18-10-8-11-22(3)26(24,25)5-2)19-13-15-21-20-14-9-6-7-12-23(14)15/h6-7,9,12H,4-5,8,10-11,13H2,1-3H3,(H2,17,18,19) |
| InChIKey | OIDNHAUQGQUICF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|