C19H26IN7 — CID 111016144
1-ethyl-3-[2-(N-methylanilino)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111016144) has the molecular formula C19H26IN7 and a molecular weight of 479.37 g/mol. Its IUPAC name is 1-ethyl-3-[2-(N-methylanilino)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(N-methylanilino)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111016144 |
| Molecular Formula | C19H26IN7 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 1-ethyl-3-[2-(N-methylanilino)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCN(C)c1ccccc1.I |
| InChI | InChI=1S/C19H25N7.HI/c1-3-20-19(21-12-14-25(2)16-9-5-4-6-10-16)22-15-18-24-23-17-11-7-8-13-26(17)18;/h4-11,13H,3,12,14-15H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | JMVNENQMYCRMPC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|