C24H30IN7O — CID 111015666
1-[2-(furan-2-yl)ethyl]-3-[3-(N-methylanilino)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111015666) has the molecular formula C24H30IN7O and a molecular weight of 559.46 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-[3-(N-methylanilino)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-[3-(N-methylanilino)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111015666 |
| Molecular Formula | C24H30IN7O |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-[3-(N-methylanilino)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CN(CCCN/C(=N\Cc1nnc2ccccn12)NCCc1ccco1)c1ccccc1.I |
| InChI | InChI=1S/C24H29N7O.HI/c1-30(20-9-3-2-4-10-20)16-8-14-25-24(26-15-13-21-11-7-18-32-21)27-19-23-29-28-22-12-5-6-17-31(22)23;/h2-7,9-12,17-18H,8,13-16,19H2,1H3,(H2,25,26,27);1H |
| InChIKey | JOLITNRPBNTJJH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 82.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|