C19H21IN6OS — CID 111015664
1-[2-(furan-2-yl)ethyl]-3-(thiophen-2-ylmethyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111015664) has the molecular formula C19H21IN6OS and a molecular weight of 508.39 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(thiophen-2-ylmethyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(thiophen-2-ylmethyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111015664 |
| Molecular Formula | C19H21IN6OS |
| Molecular Weight | 508.39 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(thiophen-2-ylmethyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | I.c1coc(CCN/C(=N\Cc2nnc3ccccn23)NCc2cccs2)c1 |
| InChI | InChI=1S/C19H20N6OS.HI/c1-2-10-25-17(7-1)23-24-18(25)14-22-19(21-13-16-6-4-12-27-16)20-9-8-15-5-3-11-26-15;/h1-7,10-12H,8-9,13-14H2,(H2,20,21,22);1H |
| InChIKey | MOBLHTQIGVIVMF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|