C19H25IN4O2S — CID 111584721
1-[2-(furan-2-yl)ethyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111584721) has the molecular formula C19H25IN4O2S and a molecular weight of 500.41 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111584721 |
| Molecular Formula | C19H25IN4O2S |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CC(C)c1cc(C/N=C(\NCCc2ccco2)NCc2cccs2)on1.I |
| InChI | InChI=1S/C19H24N4O2S.HI/c1-14(2)18-11-16(25-23-18)12-21-19(22-13-17-6-4-10-26-17)20-8-7-15-5-3-9-24-15;/h3-6,9-11,14H,7-8,12-13H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | HWHTZUSFVGPEKC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|