C14H20N4OS — CID 111813602
2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111813602) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111813602 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine |
| SMILES | CC(C)c1cc(C/N=C(\N)NCCc2cccs2)on1 |
| InChI | InChI=1S/C14H20N4OS/c1-10(2)13-8-11(19-18-13)9-17-14(15)16-6-5-12-4-3-7-20-12/h3-4,7-8,10H,5-6,9H2,1-2H3,(H3,15,16,17) |
| InChIKey | NFGIIZDQLSNFAP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|