C10H16IN7S — CID 120603223
2-[(2-methyltetrazol-5-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 120603223) has the molecular formula C10H16IN7S and a molecular weight of 393.26 g/mol. Its IUPAC name is 2-[(2-methyltetrazol-5-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(2-methyltetrazol-5-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120603223 |
| Molecular Formula | C10H16IN7S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 2-[(2-methyltetrazol-5-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | Cn1nnc(C/N=C(\N)NCCc2cccs2)n1.I |
| InChI | InChI=1S/C10H15N7S.HI/c1-17-15-9(14-16-17)7-13-10(11)12-5-4-8-3-2-6-18-8;/h2-3,6H,4-5,7H2,1H3,(H3,11,12,13);1H |
| InChIKey | FJTDGFSVCSNHQC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|