C12H22IN3S — CID 111022609
2-pentyl-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111022609) has the molecular formula C12H22IN3S and a molecular weight of 367.30 g/mol. Its IUPAC name is 2-pentyl-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-pentyl-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111022609 |
| Molecular Formula | C12H22IN3S |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-pentyl-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCCCC/N=C(\N)NCCc1cccs1.I |
| InChI | InChI=1S/C12H21N3S.HI/c1-2-3-4-8-14-12(13)15-9-7-11-6-5-10-16-11;/h5-6,10H,2-4,7-9H2,1H3,(H3,13,14,15);1H |
| InChIKey | ZNVACRIGYQMFHM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|