C10H18N4O2S2 — CID 111044052
2-[2-(methanesulfonamido)ethyl]-1-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111044052) has the molecular formula C10H18N4O2S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[2-(methanesulfonamido)ethyl]-1-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[2-(methanesulfonamido)ethyl]-1-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111044052 |
| Molecular Formula | C10H18N4O2S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[2-(methanesulfonamido)ethyl]-1-(2-thiophen-2-ylethyl)guanidine |
| SMILES | CS(=O)(=O)NCC/N=C(\N)NCCc1cccs1 |
| InChI | InChI=1S/C10H18N4O2S2/c1-18(15,16)14-7-6-13-10(11)12-5-4-9-3-2-8-17-9/h2-3,8,14H,4-7H2,1H3,(H3,11,12,13) |
| InChIKey | KBVWMQNYYLGPJY-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|