C11H20IN3S — CID 111023170
2-butyl-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111023170) has the molecular formula C11H20IN3S and a molecular weight of 353.27 g/mol. Its IUPAC name is 2-butyl-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-butyl-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111023170 |
| Molecular Formula | C11H20IN3S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 2-butyl-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCCC/N=C(\N)NCCc1cccs1.I |
| InChI | InChI=1S/C11H19N3S.HI/c1-2-3-7-13-11(12)14-8-6-10-5-4-9-15-10;/h4-5,9H,2-3,6-8H2,1H3,(H3,12,13,14);1H |
| InChIKey | MKJUHRZDZLPLIL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|