C15H23IN4S2 — CID 111098800
2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111098800) has the molecular formula C15H23IN4S2 and a molecular weight of 450.42 g/mol. Its IUPAC name is 2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111098800 |
| Molecular Formula | C15H23IN4S2 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | Cc1csc(CCCC/N=C(\N)NCCc2cccs2)n1.I |
| InChI | InChI=1S/C15H22N4S2.HI/c1-12-11-21-14(19-12)6-2-3-8-17-15(16)18-9-7-13-5-4-10-20-13;/h4-5,10-11H,2-3,6-9H2,1H3,(H3,16,17,18);1H |
| InChIKey | CZJKZYHNXGDPDY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|