C9H16N4S — CID 110935335
2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine (PubChem CID 110935335) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine.
| Compound Name | 2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine |
|---|---|
| PubChem CID | 110935335 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine |
| SMILES | Cc1csc(CCCCN=C(N)N)n1 |
| InChI | InChI=1S/C9H16N4S/c1-7-6-14-8(13-7)4-2-3-5-12-9(10)11/h6H,2-5H2,1H3,(H4,10,11,12) |
| InChIKey | YQXZKZOCQXHXAX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|