C12H22N4S — CID 111097891
1,1,3,3-tetramethyl-2-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine (PubChem CID 111097891) has the molecular formula C12H22N4S and a molecular weight of 254.40 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111097891 |
| Molecular Formula | C12H22N4S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine |
| SMILES | Cc1csc(CCCN=C(N(C)C)N(C)C)n1 |
| InChI | InChI=1S/C12H22N4S/c1-10-9-17-11(14-10)7-6-8-13-12(15(2)3)16(4)5/h9H,6-8H2,1-5H3 |
| InChIKey | POFOHFRBYNZSTQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|