C14H24N4S — CID 75495266
N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]azepane-1-carboximidamide (PubChem CID 75495266) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]azepane-1-carboximidamide.
| Compound Name | N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]azepane-1-carboximidamide |
|---|---|
| PubChem CID | 75495266 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]azepane-1-carboximidamide |
| SMILES | Cc1csc(CCC/N=C(\N)N2CCCCCC2)n1 |
| InChI | InChI=1S/C14H24N4S/c1-12-11-19-13(17-12)7-6-8-16-14(15)18-9-4-2-3-5-10-18/h11H,2-10H2,1H3,(H2,15,16) |
| InChIKey | ZDBBRTLFHZULBV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|