C12H20N4S — CID 136530651
N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]pyrrolidine-1-carboximidamide (PubChem CID 136530651) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 136530651 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]pyrrolidine-1-carboximidamide |
| SMILES | Cc1csc(C(C)C/N=C(\N)N2CCCC2)n1 |
| InChI | InChI=1S/C12H20N4S/c1-9(11-15-10(2)8-17-11)7-14-12(13)16-5-3-4-6-16/h8-9H,3-7H2,1-2H3,(H2,13,14) |
| InChIKey | JLJVPUKJAGZWDP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|