C15H22N6S2 — CID 110032546
N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 110032546) has the molecular formula C15H22N6S2 and a molecular weight of 350.52 g/mol. Its IUPAC name is N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110032546 |
| Molecular Formula | C15H22N6S2 |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | Cc1csc(C(C)C/N=C(\N)N2CCN(c3nccs3)CC2)n1 |
| InChI | InChI=1S/C15H22N6S2/c1-11(13-19-12(2)10-23-13)9-18-14(16)20-4-6-21(7-5-20)15-17-3-8-22-15/h3,8,10-11H,4-7,9H2,1-2H3,(H2,16,18) |
| InChIKey | DTPKANCMVBFYIC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|