C10H17N5S — CID 62360283
N'-ethyl-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 62360283) has the molecular formula C10H17N5S and a molecular weight of 239.35 g/mol. Its IUPAC name is N'-ethyl-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-ethyl-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 62360283 |
| Molecular Formula | C10H17N5S |
| Molecular Weight | 239.35 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N'-ethyl-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CC/N=C(\N)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C10H17N5S/c1-2-12-9(11)14-4-6-15(7-5-14)10-13-3-8-16-10/h3,8H,2,4-7H2,1H3,(H2,11,12) |
| InChIKey | GYSYTGZKUPYXKK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|