C13H23N5S2 — CID 111816554
N'-(4-methylsulfanylbutyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111816554) has the molecular formula C13H23N5S2 and a molecular weight of 313.50 g/mol. Its IUPAC name is N'-(4-methylsulfanylbutyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-(4-methylsulfanylbutyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111816554 |
| Molecular Formula | C13H23N5S2 |
| Molecular Weight | 313.50 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N'-(4-methylsulfanylbutyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CSCCCC/N=C(\N)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C13H23N5S2/c1-19-10-3-2-4-15-12(14)17-6-8-18(9-7-17)13-16-5-11-20-13/h5,11H,2-4,6-10H2,1H3,(H2,14,15) |
| InChIKey | RIBBFXWHVKHLPJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|