C13H22IN5S2 — CID 111089545
N'-(2-prop-2-enylsulfanylethyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111089545) has the molecular formula C13H22IN5S2 and a molecular weight of 439.39 g/mol. Its IUPAC name is N'-(2-prop-2-enylsulfanylethyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(2-prop-2-enylsulfanylethyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111089545 |
| Molecular Formula | C13H22IN5S2 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | N'-(2-prop-2-enylsulfanylethyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C=CCSCC/N=C(\N)N1CCN(c2nccs2)CC1.I |
| InChI | InChI=1S/C13H21N5S2.HI/c1-2-9-19-10-3-15-12(14)17-5-7-18(8-6-17)13-16-4-11-20-13;/h2,4,11H,1,3,5-10H2,(H2,14,15);1H |
| InChIKey | XAOCUDDSZAVKHB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|