C17H31N7S — CID 111060215
N'-[4-(4-methylpiperazin-1-yl)butyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111060215) has the molecular formula C17H31N7S and a molecular weight of 365.55 g/mol. Its IUPAC name is N'-[4-(4-methylpiperazin-1-yl)butyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[4-(4-methylpiperazin-1-yl)butyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111060215 |
| Molecular Formula | C17H31N7S |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | N'-[4-(4-methylpiperazin-1-yl)butyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CN1CCN(CCCC/N=C(\N)N2CCN(c3nccs3)CC2)CC1 |
| InChI | InChI=1S/C17H31N7S/c1-21-7-9-22(10-8-21)6-3-2-4-19-16(18)23-11-13-24(14-12-23)17-20-5-15-25-17/h5,15H,2-4,6-14H2,1H3,(H2,18,19) |
| InChIKey | SUYQBWFVYSAADV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|