C14H23N5O2S — CID 111086175
methyl 5-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]pentanoate (PubChem CID 111086175) has the molecular formula C14H23N5O2S and a molecular weight of 325.44 g/mol. Its IUPAC name is methyl 5-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]pentanoate.
| Compound Name | methyl 5-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]pentanoate |
|---|---|
| PubChem CID | 111086175 |
| Molecular Formula | C14H23N5O2S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | methyl 5-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]pentanoate |
| SMILES | COC(=O)CCCC/N=C(\N)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C14H23N5O2S/c1-21-12(20)4-2-3-5-16-13(15)18-7-9-19(10-8-18)14-17-6-11-22-14/h6,11H,2-5,7-10H2,1H3,(H2,15,16) |
| InChIKey | QDVSWUSIGJDRMU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|