C18H25N5OS — CID 111803614
N'-[3-(2-methylphenoxy)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111803614) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is N'-[3-(2-methylphenoxy)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[3-(2-methylphenoxy)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111803614 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N'-[3-(2-methylphenoxy)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | Cc1ccccc1OCCC/N=C(\N)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C18H25N5OS/c1-15-5-2-3-6-16(15)24-13-4-7-20-17(19)22-9-11-23(12-10-22)18-21-8-14-25-18/h2-3,5-6,8,14H,4,7,9-13H2,1H3,(H2,19,20) |
| InChIKey | MGHNNCDBPXJTDA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|