C12H22IN5S — CID 111023210
N'-butyl-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111023210) has the molecular formula C12H22IN5S and a molecular weight of 395.31 g/mol. Its IUPAC name is N'-butyl-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-butyl-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111023210 |
| Molecular Formula | C12H22IN5S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | N'-butyl-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCCC/N=C(\N)N1CCN(c2nccs2)CC1.I |
| InChI | InChI=1S/C12H21N5S.HI/c1-2-3-4-14-11(13)16-6-8-17(9-7-16)12-15-5-10-18-12;/h5,10H,2-4,6-9H2,1H3,(H2,13,14);1H |
| InChIKey | WGGBCEIBDLYTKS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|