C15H23IN6S2 — CID 111822090
N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111822090) has the molecular formula C15H23IN6S2 and a molecular weight of 478.43 g/mol. Its IUPAC name is N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111822090 |
| Molecular Formula | C15H23IN6S2 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCc1cnc(CC/N=C(\N)N2CCN(c3nccs3)CC2)s1.I |
| InChI | InChI=1S/C15H22N6S2.HI/c1-2-12-11-19-13(23-12)3-4-17-14(16)20-6-8-21(9-7-20)15-18-5-10-22-15;/h5,10-11H,2-4,6-9H2,1H3,(H2,16,17);1H |
| InChIKey | WEEQQTFZDCAQSJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|