C14H26N6S — CID 111803442
N'-[2-(tert-butylamino)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111803442) has the molecular formula C14H26N6S and a molecular weight of 310.47 g/mol. Its IUPAC name is N'-[2-(tert-butylamino)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(tert-butylamino)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111803442 |
| Molecular Formula | C14H26N6S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | N'-[2-(tert-butylamino)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CC(C)(C)NCC/N=C(\N)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C14H26N6S/c1-14(2,3)18-5-4-16-12(15)19-7-9-20(10-8-19)13-17-6-11-21-13/h6,11,18H,4-5,7-10H2,1-3H3,(H2,15,16) |
| InChIKey | SNLFUGLZLORTML-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|